C17H29N3 — CID 143866475
(Z)-but-2-ene;4-[(E)-but-2-enyl]-8-ethyl-2,6,7,9-tetrahydropyrazino[1,2-a]pyrimidine (PubChem CID 143866475) has the molecular formula C17H29N3 and a molecular weight of 275.44 g/mol. Its IUPAC name is (Z)-but-2-ene;4-[(E)-but-2-enyl]-8-ethyl-2,6,7,9-tetrahydropyrazino[1,2-a]pyrimidine.
| Compound Name | (Z)-but-2-ene;4-[(E)-but-2-enyl]-8-ethyl-2,6,7,9-tetrahydropyrazino[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 143866475 |
| Molecular Formula | C17H29N3 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.24 |
| IUPAC Name | (Z)-but-2-ene;4-[(E)-but-2-enyl]-8-ethyl-2,6,7,9-tetrahydropyrazino[1,2-a]pyrimidine |
| SMILES | C/C=C/CC1=CCN=C2CN(CC)CCN12.C/C=C\C |
| InChI | InChI=1S/C13H21N3.C4H8/c1-3-5-6-12-7-8-14-13-11-15(4-2)9-10-16(12)13;1-3-4-2/h3,5,7H,4,6,8-11H2,1-2H3;3-4H,1-2H3/b5-3+;4-3- |
| InChIKey | SQQBECCZQAKYFO-OPVYEPOASA-N |
| XLogP | 3.47 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|