About (3Z)-N-ethyl-3-ethylidene-4-methyl-6-(trifluoromethyl)octa-5,7-dien-1-amine
(3Z)-N-ethyl-3-ethylidene-4-methyl-6-(trifluoromethyl)octa-5,7-dien-1-amine (PubChem CID 143866557) has the molecular formula C14H22F3N
and a molecular weight of 261.33 g/mol. Its IUPAC name is (3Z)-N-ethyl-3-ethylidene-4-methyl-6-(trifluoromethyl)octa-5,7-dien-1-amine.
Molecular Properties
| Compound Name | (3Z)-N-ethyl-3-ethylidene-4-methyl-6-(trifluoromethyl)octa-5,7-dien-1-amine |
| PubChem CID | 143866557 |
| Molecular Formula | C14H22F3N |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (3Z)-N-ethyl-3-ethylidene-4-methyl-6-(trifluoromethyl)octa-5,7-dien-1-amine |
| SMILES | C=CC(=CC(C)/C(=C\C)CCNCC)C(F)(F)F |
| InChI | InChI=1S/C14H22F3N/c1-5-12(8-9-18-7-3)11(4)10-13(6-2)14(15,16)17/h5-6,10-11,18H,2,7-9H2,1,3-4H3/b12-5-,13-10? |
| InChIKey | UGWDDSYWTNEKGH-FIXFVXKCSA-N |
| XLogP | 4.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-N-ethyl-3-ethylidene-4-methyl-6-(trifluoromethyl)octa-5,7-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-N-ethyl-3-ethylidene-4-methyl-6-(trifluoromethyl)octa-5,7-dien-1-amine?
The IUPAC name of (3Z)-N-ethyl-3-ethylidene-4-methyl-6-(trifluoromethyl)octa-5,7-dien-1-amine (CID 143866557) is (3Z)-N-ethyl-3-ethylidene-4-methyl-6-(trifluoromethyl)octa-5,7-dien-1-amine.
What is the SMILES notation for (3Z)-N-ethyl-3-ethylidene-4-methyl-6-(trifluoromethyl)octa-5,7-dien-1-amine?
The canonical SMILES for (3Z)-N-ethyl-3-ethylidene-4-methyl-6-(trifluoromethyl)octa-5,7-dien-1-amine is C=CC(=CC(C)/C(=C\C)CCNCC)C(F)(F)F.
What is the InChIKey of (3Z)-N-ethyl-3-ethylidene-4-methyl-6-(trifluoromethyl)octa-5,7-dien-1-amine?
The InChIKey is UGWDDSYWTNEKGH-FIXFVXKCSA-N. The full InChI is InChI=1S/C14H22F3N/c1-5-12(8-9-18-7-3)11(4)10-13(6-2)14(15,16)17/h5-6,10-11,18H,2,7-9H2,1,3-4H3/b12-5-,13-10?.
What are the key properties of (3Z)-N-ethyl-3-ethylidene-4-methyl-6-(trifluoromethyl)octa-5,7-dien-1-amine?
(3Z)-N-ethyl-3-ethylidene-4-methyl-6-(trifluoromethyl)octa-5,7-dien-1-amine has a molecular weight of 261.33 g/mol, XLogP of 4.24, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-N-ethyl-3-ethylidene-4-methyl-6-(trifluoromethyl)octa-5,7-dien-1-amine is sourced from PubChem (CID 143866557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).