C38H56N4O3 — CID 143866823
6-(2-acetamidobutanoylamino)-N-(4-aminobutyl)hexanamide;1,1-diphenylethylbenzene;ethane (PubChem CID 143866823) has the molecular formula C38H56N4O3 and a molecular weight of 616.89 g/mol. Its IUPAC name is 6-(2-acetamidobutanoylamino)-N-(4-aminobutyl)hexanamide;1,1-diphenylethylbenzene;ethane.
| Compound Name | 6-(2-acetamidobutanoylamino)-N-(4-aminobutyl)hexanamide;1,1-diphenylethylbenzene;ethane |
|---|---|
| PubChem CID | 143866823 |
| Molecular Formula | C38H56N4O3 |
| Molecular Weight | 616.89 g/mol |
| Exact Mass | 616.44 |
| IUPAC Name | 6-(2-acetamidobutanoylamino)-N-(4-aminobutyl)hexanamide;1,1-diphenylethylbenzene;ethane |
| SMILES | CC.CC(c1ccccc1)(c1ccccc1)c1ccccc1.CCC(NC(C)=O)C(=O)NCCCCCC(=O)NCCCCN |
| InChI | InChI=1S/C20H18.C16H32N4O3.C2H6/c1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;1-3-14(20-13(2)21)16(23)19-12-7-4-5-9-15(22)18-11-8-6-10-17;1-2/h2-16H,1H3;14H,3-12,17H2,1-2H3,(H,18,22)(H,19,23)(H,20,21);1-2H3 |
| InChIKey | FXHFHDYNCYVVHY-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.89 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|