About ethenyl N-ethenylpentanimidothioate;2-methylpropane
ethenyl N-ethenylpentanimidothioate;2-methylpropane (PubChem CID 143866979) has the molecular formula C13H25NS
and a molecular weight of 227.42 g/mol. Its IUPAC name is ethenyl N-ethenylpentanimidothioate;2-methylpropane.
Molecular Properties
| Compound Name | ethenyl N-ethenylpentanimidothioate;2-methylpropane |
| PubChem CID | 143866979 |
| Molecular Formula | C13H25NS |
| Molecular Weight | 227.42 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | ethenyl N-ethenylpentanimidothioate;2-methylpropane |
| SMILES | C=C/N=C(/CCCC)SC=C.CC(C)C |
| InChI | InChI=1S/C9H15NS.C4H10/c1-4-7-8-9(10-5-2)11-6-3;1-4(2)3/h5-6H,2-4,7-8H2,1H3;4H,1-3H3/b10-9-; |
| InChIKey | WJRIOCVDVHGVIW-KVVVOXFISA-N |
| XLogP | 5.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 227.42 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethenyl N-ethenylpentanimidothioate;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl N-ethenylpentanimidothioate;2-methylpropane?
The IUPAC name of ethenyl N-ethenylpentanimidothioate;2-methylpropane (CID 143866979) is ethenyl N-ethenylpentanimidothioate;2-methylpropane.
What is the SMILES notation for ethenyl N-ethenylpentanimidothioate;2-methylpropane?
The canonical SMILES for ethenyl N-ethenylpentanimidothioate;2-methylpropane is C=C/N=C(/CCCC)SC=C.CC(C)C.
What is the InChIKey of ethenyl N-ethenylpentanimidothioate;2-methylpropane?
The InChIKey is WJRIOCVDVHGVIW-KVVVOXFISA-N. The full InChI is InChI=1S/C9H15NS.C4H10/c1-4-7-8-9(10-5-2)11-6-3;1-4(2)3/h5-6H,2-4,7-8H2,1H3;4H,1-3H3/b10-9-;.
What are the key properties of ethenyl N-ethenylpentanimidothioate;2-methylpropane?
ethenyl N-ethenylpentanimidothioate;2-methylpropane has a molecular weight of 227.42 g/mol, XLogP of 5.26, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl N-ethenylpentanimidothioate;2-methylpropane is sourced from PubChem (CID 143866979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).