C18H34F3NO2S — CID 143867500
N-[(5R,6R)-8-cyclohexyl-6-ethyl-5-methyloctyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 143867500) has the molecular formula C18H34F3NO2S and a molecular weight of 385.54 g/mol. Its IUPAC name is N-[(5R,6R)-8-cyclohexyl-6-ethyl-5-methyloctyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[(5R,6R)-8-cyclohexyl-6-ethyl-5-methyloctyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 143867500 |
| Molecular Formula | C18H34F3NO2S |
| Molecular Weight | 385.54 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | N-[(5R,6R)-8-cyclohexyl-6-ethyl-5-methyloctyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | CCC(CCC1CCCCC1)[C@H](C)CCCCNS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C18H34F3NO2S/c1-3-17(13-12-16-10-5-4-6-11-16)15(2)9-7-8-14-22-25(23,24)18(19,20)21/h15-17,22H,3-14H2,1-2H3/t15-,17?/m1/s1 |
| InChIKey | DUXSPEKINRYKBQ-LDCVWXEPSA-N |
| XLogP | 5.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.54 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|