C14H22OS2 — CID 14386762
3,3-bis(ethylsulfanyl)-4,4a,5,6,7,8-hexahydronaphthalen-2-one (PubChem CID 14386762) has the molecular formula C14H22OS2 and a molecular weight of 270.46 g/mol. Its IUPAC name is 3,3-bis(ethylsulfanyl)-4,4a,5,6,7,8-hexahydronaphthalen-2-one.
| Compound Name | 3,3-bis(ethylsulfanyl)-4,4a,5,6,7,8-hexahydronaphthalen-2-one |
|---|---|
| PubChem CID | 14386762 |
| Molecular Formula | C14H22OS2 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 3,3-bis(ethylsulfanyl)-4,4a,5,6,7,8-hexahydronaphthalen-2-one |
| SMILES | CCSC1(SCC)CC2CCCCC2=CC1=O |
| InChI | InChI=1S/C14H22OS2/c1-3-16-14(17-4-2)10-12-8-6-5-7-11(12)9-13(14)15/h9,12H,3-8,10H2,1-2H3 |
| InChIKey | PXBRPYMNVCJQQC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|