C10H8Cl2N2O6 — CID 14386792
methyl N-[2,5-dichloro-4-(methoxycarbonylamino)-3,6-dioxocyclohexa-1,4-dien-1-yl]carbamate (PubChem CID 14386792) has the molecular formula C10H8Cl2N2O6 and a molecular weight of 323.09 g/mol. Its IUPAC name is methyl N-[2,5-dichloro-4-(methoxycarbonylamino)-3,6-dioxocyclohexa-1,4-dien-1-yl]carbamate.
| Compound Name | methyl N-[2,5-dichloro-4-(methoxycarbonylamino)-3,6-dioxocyclohexa-1,4-dien-1-yl]carbamate |
|---|---|
| PubChem CID | 14386792 |
| Molecular Formula | C10H8Cl2N2O6 |
| Molecular Weight | 323.09 g/mol |
| Exact Mass | 321.98 |
| IUPAC Name | methyl N-[2,5-dichloro-4-(methoxycarbonylamino)-3,6-dioxocyclohexa-1,4-dien-1-yl]carbamate |
| SMILES | COC(=O)NC1=C(Cl)C(=O)C(NC(=O)OC)=C(Cl)C1=O |
| InChI | InChI=1S/C10H8Cl2N2O6/c1-19-9(17)13-5-3(11)8(16)6(4(12)7(5)15)14-10(18)20-2/h1-2H3,(H,13,17)(H,14,18) |
| InChIKey | MTPDSDQDIYARMN-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.09 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|