C17H17F4N4O+ — CID 143868370
[amino-(3-fluorophenyl)methylidene]-[2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetyl]azanium (PubChem CID 143868370) has the molecular formula C17H17F4N4O+ and a molecular weight of 369.34 g/mol. Its IUPAC name is [amino-(3-fluorophenyl)methylidene]-[2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetyl]azanium.
| Compound Name | [amino-(3-fluorophenyl)methylidene]-[2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetyl]azanium |
|---|---|
| PubChem CID | 143868370 |
| Molecular Formula | C17H17F4N4O+ |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | [amino-(3-fluorophenyl)methylidene]-[2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetyl]azanium |
| SMILES | N/C(=[NH+]\C(=O)Cn1nc(C(F)(F)F)c2c1CCCC2)c1cccc(F)c1 |
| InChI | InChI=1S/C17H16F4N4O/c18-11-5-3-4-10(8-11)16(22)23-14(26)9-25-13-7-2-1-6-12(13)15(24-25)17(19,20)21/h3-5,8H,1-2,6-7,9H2,(H2,22,23,26)/p+1 |
| InChIKey | VNVNDADQRQXZTN-UHFFFAOYSA-O |
| XLogP | 0.93 |
| TPSA | 74.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|