C18H16F6N8O — CID 143868404
N-[amino-[5-methyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridin-1-yl]acetamide (PubChem CID 143868404) has the molecular formula C18H16F6N8O and a molecular weight of 474.37 g/mol. Its IUPAC name is N-[amino-[5-methyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridin-1-yl]acetamide.
| Compound Name | N-[amino-[5-methyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridin-1-yl]acetamide |
|---|---|
| PubChem CID | 143868404 |
| Molecular Formula | C18H16F6N8O |
| Molecular Weight | 474.37 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | N-[amino-[5-methyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridin-1-yl]acetamide |
| SMILES | Cc1cc(C(F)(F)F)n2ncc(/C(N)=N/C(=O)Cn3nc(C(F)(F)F)c4c3CCNC4)c2n1 |
| InChI | InChI=1S/C18H16F6N8O/c1-8-4-12(17(19,20)21)32-16(28-8)10(6-27-32)15(25)29-13(33)7-31-11-2-3-26-5-9(11)14(30-31)18(22,23)24/h4,6,26H,2-3,5,7H2,1H3,(H2,25,29,33) |
| InChIKey | UJOITEMICYVPEI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 115.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|