C26H53S+ — CID 143869335
dibutyl-(1,4-dimethylcyclohex-3-en-1-yl)sulfanium;ethane;2,4,4-trimethylpent-1-ene (PubChem CID 143869335) has the molecular formula C26H53S+ and a molecular weight of 397.78 g/mol. Its IUPAC name is dibutyl-(1,4-dimethylcyclohex-3-en-1-yl)sulfanium;ethane;2,4,4-trimethylpent-1-ene.
| Compound Name | dibutyl-(1,4-dimethylcyclohex-3-en-1-yl)sulfanium;ethane;2,4,4-trimethylpent-1-ene |
|---|---|
| PubChem CID | 143869335 |
| Molecular Formula | C26H53S+ |
| Molecular Weight | 397.78 g/mol |
| Exact Mass | 397.39 |
| IUPAC Name | dibutyl-(1,4-dimethylcyclohex-3-en-1-yl)sulfanium;ethane;2,4,4-trimethylpent-1-ene |
| SMILES | C=C(C)CC(C)(C)C.CC.CCCC[S+](CCCC)C1(C)CC=C(C)CC1 |
| InChI | InChI=1S/C16H31S.C8H16.C2H6/c1-5-7-13-17(14-8-6-2)16(4)11-9-15(3)10-12-16;1-7(2)6-8(3,4)5;1-2/h9H,5-8,10-14H2,1-4H3;1,6H2,2-5H3;1-2H3/q+1;; |
| InChIKey | OVQZZCLIXRSZIV-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.78 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|