C18H17FN4O6S — CID 143869771
ethyl 2-amino-2-[1-(4-fluorophenyl)sulfonyl-2,3-dihydropyrido[2,3-b][1,4]oxazine-7-carbonyl]iminoacetate (PubChem CID 143869771) has the molecular formula C18H17FN4O6S and a molecular weight of 436.42 g/mol. Its IUPAC name is ethyl 2-amino-2-[1-(4-fluorophenyl)sulfonyl-2,3-dihydropyrido[2,3-b][1,4]oxazine-7-carbonyl]iminoacetate.
| Compound Name | ethyl 2-amino-2-[1-(4-fluorophenyl)sulfonyl-2,3-dihydropyrido[2,3-b][1,4]oxazine-7-carbonyl]iminoacetate |
|---|---|
| PubChem CID | 143869771 |
| Molecular Formula | C18H17FN4O6S |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | ethyl 2-amino-2-[1-(4-fluorophenyl)sulfonyl-2,3-dihydropyrido[2,3-b][1,4]oxazine-7-carbonyl]iminoacetate |
| SMILES | CCOC(=O)/C(N)=N/C(=O)c1cnc2c(c1)N(S(=O)(=O)c1ccc(F)cc1)CCO2 |
| InChI | InChI=1S/C18H17FN4O6S/c1-2-28-18(25)15(20)22-16(24)11-9-14-17(21-10-11)29-8-7-23(14)30(26,27)13-5-3-12(19)4-6-13/h3-6,9-10H,2,7-8H2,1H3,(H2,20,22,24) |
| InChIKey | ZGRQIZWOBIVVGF-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 141.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|