C9H20NO3P — CID 14387013
N,N-diethyl-5,5-dimethyl-2-oxo-1,3,2lambda5-dioxaphosphinan-2-amine (PubChem CID 14387013) has the molecular formula C9H20NO3P and a molecular weight of 221.24 g/mol. Its IUPAC name is N,N-diethyl-5,5-dimethyl-2-oxo-1,3,2lambda5-dioxaphosphinan-2-amine.
| Compound Name | N,N-diethyl-5,5-dimethyl-2-oxo-1,3,2lambda5-dioxaphosphinan-2-amine |
|---|---|
| PubChem CID | 14387013 |
| Molecular Formula | C9H20NO3P |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | N,N-diethyl-5,5-dimethyl-2-oxo-1,3,2lambda5-dioxaphosphinan-2-amine |
| SMILES | CCN(CC)P1(=O)OCC(C)(C)CO1 |
| InChI | InChI=1S/C9H20NO3P/c1-5-10(6-2)14(11)12-7-9(3,4)8-13-14/h5-8H2,1-4H3 |
| InChIKey | BFVAMYACFMNCFG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|