C19H22N2O2 — CID 143870425
acetylene;N-[(4E,5E)-4,5-di(ethylidene)-2-(4-methoxyphenyl)-1H-pyrrol-3-yl]acetamide (PubChem CID 143870425) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is acetylene;N-[(4E,5E)-4,5-di(ethylidene)-2-(4-methoxyphenyl)-1H-pyrrol-3-yl]acetamide.
| Compound Name | acetylene;N-[(4E,5E)-4,5-di(ethylidene)-2-(4-methoxyphenyl)-1H-pyrrol-3-yl]acetamide |
|---|---|
| PubChem CID | 143870425 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | acetylene;N-[(4E,5E)-4,5-di(ethylidene)-2-(4-methoxyphenyl)-1H-pyrrol-3-yl]acetamide |
| SMILES | C#C.C/C=c1/c(NC(C)=O)c(-c2ccc(OC)cc2)[nH]/c1=C/C |
| InChI | InChI=1S/C17H20N2O2.C2H2/c1-5-14-15(6-2)19-16(17(14)18-11(3)20)12-7-9-13(21-4)10-8-12;1-2/h5-10,19H,1-4H3,(H,18,20);1-2H/b14-5+,15-6+; |
| InChIKey | IWSMFYPAUKORIK-MCOMNPAFSA-N |
| XLogP | 2.50 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|