C17H21NO4S — CID 143870432
2-[(2-acetylthiophen-3-yl)amino]-2-(4-methoxyphenyl)acetic acid;ethane (PubChem CID 143870432) has the molecular formula C17H21NO4S and a molecular weight of 335.43 g/mol. Its IUPAC name is 2-[(2-acetylthiophen-3-yl)amino]-2-(4-methoxyphenyl)acetic acid;ethane.
| Compound Name | 2-[(2-acetylthiophen-3-yl)amino]-2-(4-methoxyphenyl)acetic acid;ethane |
|---|---|
| PubChem CID | 143870432 |
| Molecular Formula | C17H21NO4S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2-[(2-acetylthiophen-3-yl)amino]-2-(4-methoxyphenyl)acetic acid;ethane |
| SMILES | CC.COc1ccc(C(Nc2ccsc2C(C)=O)C(=O)O)cc1 |
| InChI | InChI=1S/C15H15NO4S.C2H6/c1-9(17)14-12(7-8-21-14)16-13(15(18)19)10-3-5-11(20-2)6-4-10;1-2/h3-8,13,16H,1-2H3,(H,18,19);1-2H3 |
| InChIKey | JDJOOYSMUDHUOG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |