C31H46N2 — CID 143870487
(1Z,3Z,5Z)-N-[(2E,4E,6E)-7-[5-[(Z)-but-2-enyl]-4-ethenyl-3,3-dimethyl-1,2-dihydropyrrol-2-yl]hepta-2,4,6-trien-2-yl]-2-tert-butyl-N-methylhepta-1,3,5-trien-1-amine (PubChem CID 143870487) has the molecular formula C31H46N2 and a molecular weight of 446.72 g/mol. Its IUPAC name is (1Z,3Z,5Z)-N-[(2E,4E,6E)-7-[5-[(Z)-but-2-enyl]-4-ethenyl-3,3-dimethyl-1,2-dihydropyrrol-2-yl]hepta-2,4,6-trien-2-yl]-2-tert-butyl-N-methylhepta-1,3,5-trien-1-amine.
| Compound Name | (1Z,3Z,5Z)-N-[(2E,4E,6E)-7-[5-[(Z)-but-2-enyl]-4-ethenyl-3,3-dimethyl-1,2-dihydropyrrol-2-yl]hepta-2,4,6-trien-2-yl]-2-tert-butyl-N-methylhepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 143870487 |
| Molecular Formula | C31H46N2 |
| Molecular Weight | 446.72 g/mol |
| Exact Mass | 446.37 |
| IUPAC Name | (1Z,3Z,5Z)-N-[(2E,4E,6E)-7-[5-[(Z)-but-2-enyl]-4-ethenyl-3,3-dimethyl-1,2-dihydropyrrol-2-yl]hepta-2,4,6-trien-2-yl]-2-tert-butyl-N-methylhepta-1,3,5-trien-1-amine |
| SMILES | C=CC1=C(C/C=C\C)NC(/C=C/C=C/C=C(\C)N(C)/C=C(/C=C\C=C/C)C(C)(C)C)C1(C)C |
| InChI | InChI=1S/C31H46N2/c1-11-14-17-21-26(30(5,6)7)24-33(10)25(4)20-18-16-19-23-29-31(8,9)27(13-3)28(32-29)22-15-12-2/h11-21,23-24,29,32H,3,22H2,1-2,4-10H3/b14-11-,15-12-,18-16+,21-17-,23-19+,25-20+,26-24- |
| InChIKey | CBYQMFDTHLVQCV-OATQHGJBSA-N |
| XLogP | 8.40 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.72 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|