About (2Z)-2-(methylideneamino)-N-pentylpenta-2,4-dien-1-amine
(2Z)-2-(methylideneamino)-N-pentylpenta-2,4-dien-1-amine (PubChem CID 143870555) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is (2Z)-2-(methylideneamino)-N-pentylpenta-2,4-dien-1-amine.
Molecular Properties
| Compound Name | (2Z)-2-(methylideneamino)-N-pentylpenta-2,4-dien-1-amine |
| PubChem CID | 143870555 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | (2Z)-2-(methylideneamino)-N-pentylpenta-2,4-dien-1-amine |
| SMILES | C=C/C=C(/CNCCCCC)N=C |
| InChI | InChI=1S/C11H20N2/c1-4-6-7-9-13-10-11(12-3)8-5-2/h5,8,13H,2-4,6-7,9-10H2,1H3/b11-8- |
| InChIKey | UIDXSHMUFRQKHZ-FLIBITNWSA-N |
| XLogP | 2.54 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-(methylideneamino)-N-pentylpenta-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-(methylideneamino)-N-pentylpenta-2,4-dien-1-amine?
The IUPAC name of (2Z)-2-(methylideneamino)-N-pentylpenta-2,4-dien-1-amine (CID 143870555) is (2Z)-2-(methylideneamino)-N-pentylpenta-2,4-dien-1-amine.
What is the SMILES notation for (2Z)-2-(methylideneamino)-N-pentylpenta-2,4-dien-1-amine?
The canonical SMILES for (2Z)-2-(methylideneamino)-N-pentylpenta-2,4-dien-1-amine is C=C/C=C(/CNCCCCC)N=C.
What is the InChIKey of (2Z)-2-(methylideneamino)-N-pentylpenta-2,4-dien-1-amine?
The InChIKey is UIDXSHMUFRQKHZ-FLIBITNWSA-N. The full InChI is InChI=1S/C11H20N2/c1-4-6-7-9-13-10-11(12-3)8-5-2/h5,8,13H,2-4,6-7,9-10H2,1H3/b11-8-.
What are the key properties of (2Z)-2-(methylideneamino)-N-pentylpenta-2,4-dien-1-amine?
(2Z)-2-(methylideneamino)-N-pentylpenta-2,4-dien-1-amine has a molecular weight of 180.29 g/mol, XLogP of 2.54, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-(methylideneamino)-N-pentylpenta-2,4-dien-1-amine is sourced from PubChem (CID 143870555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).