C26H33N7 — CID 143870668
(Z)-3-[N-amino-2-[(pyridin-2-ylmethylamino)methyl]anilino]-1-N-methyl-1-N-(5,6,7,8-tetrahydroquinolin-8-yl)prop-2-ene-1,2-diamine (PubChem CID 143870668) has the molecular formula C26H33N7 and a molecular weight of 443.60 g/mol. Its IUPAC name is (Z)-3-[N-amino-2-[(pyridin-2-ylmethylamino)methyl]anilino]-1-N-methyl-1-N-(5,6,7,8-tetrahydroquinolin-8-yl)prop-2-ene-1,2-diamine.
| Compound Name | (Z)-3-[N-amino-2-[(pyridin-2-ylmethylamino)methyl]anilino]-1-N-methyl-1-N-(5,6,7,8-tetrahydroquinolin-8-yl)prop-2-ene-1,2-diamine |
|---|---|
| PubChem CID | 143870668 |
| Molecular Formula | C26H33N7 |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | (Z)-3-[N-amino-2-[(pyridin-2-ylmethylamino)methyl]anilino]-1-N-methyl-1-N-(5,6,7,8-tetrahydroquinolin-8-yl)prop-2-ene-1,2-diamine |
| SMILES | CN(C/C(N)=C/N(N)c1ccccc1CNCc1ccccn1)C1CCCc2cccnc21 |
| InChI | InChI=1S/C26H33N7/c1-32(25-13-6-9-20-10-7-15-31-26(20)25)18-22(27)19-33(28)24-12-3-2-8-21(24)16-29-17-23-11-4-5-14-30-23/h2-5,7-8,10-12,14-15,19,25,29H,6,9,13,16-18,27-28H2,1H3/b22-19- |
| InChIKey | LEZBTPDDXZPERM-QOCHGBHMSA-N |
| XLogP | 3.26 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|