About [4-amino-2,6-bis(trifluoromethyl)pyrimidin-5-yl]methanol
[4-amino-2,6-bis(trifluoromethyl)pyrimidin-5-yl]methanol (PubChem CID 14387088) has the molecular formula C7H5F6N3O
and a molecular weight of 261.12 g/mol. Its IUPAC name is [4-amino-2,6-bis(trifluoromethyl)pyrimidin-5-yl]methanol.
Molecular Properties
| Compound Name | [4-amino-2,6-bis(trifluoromethyl)pyrimidin-5-yl]methanol |
| PubChem CID | 14387088 |
| Molecular Formula | C7H5F6N3O |
| Molecular Weight | 261.12 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | [4-amino-2,6-bis(trifluoromethyl)pyrimidin-5-yl]methanol |
| SMILES | Nc1nc(C(F)(F)F)nc(C(F)(F)F)c1CO |
| InChI | InChI=1S/C7H5F6N3O/c8-6(9,10)3-2(1-17)4(14)16-5(15-3)7(11,12)13/h17H,1H2,(H2,14,15,16) |
| InChIKey | BYPZJJOGTFNHCH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.12 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-amino-2,6-bis(trifluoromethyl)pyrimidin-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-amino-2,6-bis(trifluoromethyl)pyrimidin-5-yl]methanol?
The IUPAC name of [4-amino-2,6-bis(trifluoromethyl)pyrimidin-5-yl]methanol (CID 14387088) is [4-amino-2,6-bis(trifluoromethyl)pyrimidin-5-yl]methanol.
What is the SMILES notation for [4-amino-2,6-bis(trifluoromethyl)pyrimidin-5-yl]methanol?
The canonical SMILES for [4-amino-2,6-bis(trifluoromethyl)pyrimidin-5-yl]methanol is Nc1nc(C(F)(F)F)nc(C(F)(F)F)c1CO.
What is the InChIKey of [4-amino-2,6-bis(trifluoromethyl)pyrimidin-5-yl]methanol?
The InChIKey is BYPZJJOGTFNHCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F6N3O/c8-6(9,10)3-2(1-17)4(14)16-5(15-3)7(11,12)13/h17H,1H2,(H2,14,15,16).
What are the key properties of [4-amino-2,6-bis(trifluoromethyl)pyrimidin-5-yl]methanol?
[4-amino-2,6-bis(trifluoromethyl)pyrimidin-5-yl]methanol has a molecular weight of 261.12 g/mol, XLogP of 1.59, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-amino-2,6-bis(trifluoromethyl)pyrimidin-5-yl]methanol is sourced from PubChem (CID 14387088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).