C20H24ClN — CID 143871078
N-[[1-(4-chlorophenyl)cyclobutyl]-(2-methylphenyl)methyl]ethanamine (PubChem CID 143871078) has the molecular formula C20H24ClN and a molecular weight of 313.87 g/mol. Its IUPAC name is N-[[1-(4-chlorophenyl)cyclobutyl]-(2-methylphenyl)methyl]ethanamine.
| Compound Name | N-[[1-(4-chlorophenyl)cyclobutyl]-(2-methylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 143871078 |
| Molecular Formula | C20H24ClN |
| Molecular Weight | 313.87 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | N-[[1-(4-chlorophenyl)cyclobutyl]-(2-methylphenyl)methyl]ethanamine |
| SMILES | CCNC(c1ccccc1C)C1(c2ccc(Cl)cc2)CCC1 |
| InChI | InChI=1S/C20H24ClN/c1-3-22-19(18-8-5-4-7-15(18)2)20(13-6-14-20)16-9-11-17(21)12-10-16/h4-5,7-12,19,22H,3,6,13-14H2,1-2H3 |
| InChIKey | ZSCJUKKWXPGWDS-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.87 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |