C13H17F3N4O2 — CID 143871148
5-methanimidoyl-4-(oxolan-3-ylamino)-2-(3,3,3-trifluoro-2-methylpropyl)-1H-pyrimidin-6-one (PubChem CID 143871148) has the molecular formula C13H17F3N4O2 and a molecular weight of 318.30 g/mol. Its IUPAC name is 5-methanimidoyl-4-(oxolan-3-ylamino)-2-(3,3,3-trifluoro-2-methylpropyl)-1H-pyrimidin-6-one.
| Compound Name | 5-methanimidoyl-4-(oxolan-3-ylamino)-2-(3,3,3-trifluoro-2-methylpropyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 143871148 |
| Molecular Formula | C13H17F3N4O2 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 5-methanimidoyl-4-(oxolan-3-ylamino)-2-(3,3,3-trifluoro-2-methylpropyl)-1H-pyrimidin-6-one |
| SMILES | [H]/N=C/c1c(NC2CCOC2)nc(CC(C)C(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C13H17F3N4O2/c1-7(13(14,15)16)4-10-19-11(9(5-17)12(21)20-10)18-8-2-3-22-6-8/h5,7-8,17H,2-4,6H2,1H3,(H2,18,19,20,21)/b17-5+ |
| InChIKey | OUQRXVCUHVUDTH-YAXRCOADSA-N |
| XLogP | 1.71 |
| TPSA | 90.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|