About 5-methanimidoyl-4-[[(2R,4R)-2-methyloxan-4-yl]amino]-2-(2-methylpropyl)-1H-pyrimidin-6-one
5-methanimidoyl-4-[[(2R,4R)-2-methyloxan-4-yl]amino]-2-(2-methylpropyl)-1H-pyrimidin-6-one (PubChem CID 143871202) has the molecular formula C15H24N4O2
and a molecular weight of 292.38 g/mol. Its IUPAC name is 5-methanimidoyl-4-[[(2R,4R)-2-methyloxan-4-yl]amino]-2-(2-methylpropyl)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-methanimidoyl-4-[[(2R,4R)-2-methyloxan-4-yl]amino]-2-(2-methylpropyl)-1H-pyrimidin-6-one |
| PubChem CID | 143871202 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 5-methanimidoyl-4-[[(2R,4R)-2-methyloxan-4-yl]amino]-2-(2-methylpropyl)-1H-pyrimidin-6-one |
| SMILES | [H]/N=C/c1c(N[C@@H]2CCO[C@H](C)C2)nc(CC(C)C)[nH]c1=O |
| InChI | InChI=1S/C15H24N4O2/c1-9(2)6-13-18-14(12(8-16)15(20)19-13)17-11-4-5-21-10(3)7-11/h8-11,16H,4-7H2,1-3H3,(H2,17,18,19,20)/b16-8+/t10-,11-/m1/s1 |
| InChIKey | IKMQSWMYVMLEFY-YAGJMYGCSA-N |
| XLogP | 1.95 |
| TPSA | 90.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-methanimidoyl-4-[[(2R,4R)-2-methyloxan-4-yl]amino]-2-(2-methylpropyl)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methanimidoyl-4-[[(2R,4R)-2-methyloxan-4-yl]amino]-2-(2-methylpropyl)-1H-pyrimidin-6-one?
The IUPAC name of 5-methanimidoyl-4-[[(2R,4R)-2-methyloxan-4-yl]amino]-2-(2-methylpropyl)-1H-pyrimidin-6-one (CID 143871202) is 5-methanimidoyl-4-[[(2R,4R)-2-methyloxan-4-yl]amino]-2-(2-methylpropyl)-1H-pyrimidin-6-one.
What is the SMILES notation for 5-methanimidoyl-4-[[(2R,4R)-2-methyloxan-4-yl]amino]-2-(2-methylpropyl)-1H-pyrimidin-6-one?
The canonical SMILES for 5-methanimidoyl-4-[[(2R,4R)-2-methyloxan-4-yl]amino]-2-(2-methylpropyl)-1H-pyrimidin-6-one is [H]/N=C/c1c(N[C@@H]2CCO[C@H](C)C2)nc(CC(C)C)[nH]c1=O.
What is the InChIKey of 5-methanimidoyl-4-[[(2R,4R)-2-methyloxan-4-yl]amino]-2-(2-methylpropyl)-1H-pyrimidin-6-one?
The InChIKey is IKMQSWMYVMLEFY-YAGJMYGCSA-N. The full InChI is InChI=1S/C15H24N4O2/c1-9(2)6-13-18-14(12(8-16)15(20)19-13)17-11-4-5-21-10(3)7-11/h8-11,16H,4-7H2,1-3H3,(H2,17,18,19,20)/b16-8+/t10-,11-/m1/s1.
What are the key properties of 5-methanimidoyl-4-[[(2R,4R)-2-methyloxan-4-yl]amino]-2-(2-methylpropyl)-1H-pyrimidin-6-one?
5-methanimidoyl-4-[[(2R,4R)-2-methyloxan-4-yl]amino]-2-(2-methylpropyl)-1H-pyrimidin-6-one has a molecular weight of 292.38 g/mol, XLogP of 1.95, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methanimidoyl-4-[[(2R,4R)-2-methyloxan-4-yl]amino]-2-(2-methylpropyl)-1H-pyrimidin-6-one is sourced from PubChem (CID 143871202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).