About 4-pyrazol-1-yl-1,3-thiazole
4-pyrazol-1-yl-1,3-thiazole (PubChem CID 14387161) has the molecular formula C6H5N3S
and a molecular weight of 151.19 g/mol. Its IUPAC name is 4-pyrazol-1-yl-1,3-thiazole.
Molecular Properties
| Compound Name | 4-pyrazol-1-yl-1,3-thiazole |
| PubChem CID | 14387161 |
| Molecular Formula | C6H5N3S |
| Molecular Weight | 151.19 g/mol |
| Exact Mass | 151.02 |
| IUPAC Name | 4-pyrazol-1-yl-1,3-thiazole |
| SMILES | c1cnn(-c2cscn2)c1 |
| InChI | InChI=1S/C6H5N3S/c1-2-8-9(3-1)6-4-10-5-7-6/h1-5H |
| InChIKey | PJUQIYFTAVZSKE-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.19 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-pyrazol-1-yl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyrazol-1-yl-1,3-thiazole?
The IUPAC name of 4-pyrazol-1-yl-1,3-thiazole (CID 14387161) is 4-pyrazol-1-yl-1,3-thiazole.
What is the SMILES notation for 4-pyrazol-1-yl-1,3-thiazole?
The canonical SMILES for 4-pyrazol-1-yl-1,3-thiazole is c1cnn(-c2cscn2)c1.
What is the InChIKey of 4-pyrazol-1-yl-1,3-thiazole?
The InChIKey is PJUQIYFTAVZSKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3S/c1-2-8-9(3-1)6-4-10-5-7-6/h1-5H.
What are the key properties of 4-pyrazol-1-yl-1,3-thiazole?
4-pyrazol-1-yl-1,3-thiazole has a molecular weight of 151.19 g/mol, XLogP of 1.33, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyrazol-1-yl-1,3-thiazole is sourced from PubChem (CID 14387161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).