About 7,7-dimethylcyclohepta[d][1,3]thiazole
7,7-dimethylcyclohepta[d][1,3]thiazole (PubChem CID 143871736) has the molecular formula C10H11NS
and a molecular weight of 177.27 g/mol. Its IUPAC name is 7,7-dimethylcyclohepta[d][1,3]thiazole.
Molecular Properties
| Compound Name | 7,7-dimethylcyclohepta[d][1,3]thiazole |
| PubChem CID | 143871736 |
| Molecular Formula | C10H11NS |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 7,7-dimethylcyclohepta[d][1,3]thiazole |
| SMILES | CC1(C)C=CC=c2ncsc2=C1 |
| InChI | InChI=1S/C10H11NS/c1-10(2)5-3-4-8-9(6-10)12-7-11-8/h3-7H,1-2H3 |
| InChIKey | FXRKNSKKBWIIDY-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7,7-dimethylcyclohepta[d][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-dimethylcyclohepta[d][1,3]thiazole?
The IUPAC name of 7,7-dimethylcyclohepta[d][1,3]thiazole (CID 143871736) is 7,7-dimethylcyclohepta[d][1,3]thiazole.
What is the SMILES notation for 7,7-dimethylcyclohepta[d][1,3]thiazole?
The canonical SMILES for 7,7-dimethylcyclohepta[d][1,3]thiazole is CC1(C)C=CC=c2ncsc2=C1.
What is the InChIKey of 7,7-dimethylcyclohepta[d][1,3]thiazole?
The InChIKey is FXRKNSKKBWIIDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NS/c1-10(2)5-3-4-8-9(6-10)12-7-11-8/h3-7H,1-2H3.
What are the key properties of 7,7-dimethylcyclohepta[d][1,3]thiazole?
7,7-dimethylcyclohepta[d][1,3]thiazole has a molecular weight of 177.27 g/mol, XLogP of 1.30, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-dimethylcyclohepta[d][1,3]thiazole is sourced from PubChem (CID 143871736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).