C21H24O5 — CID 143871846
6a-hydroxy-8-(1-hydroxycyclohexa-2,4-dien-1-yl)-6,9a-dimethyl-3-methylidene-4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan-2,9-dione (PubChem CID 143871846) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is 6a-hydroxy-8-(1-hydroxycyclohexa-2,4-dien-1-yl)-6,9a-dimethyl-3-methylidene-4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan-2,9-dione.
| Compound Name | 6a-hydroxy-8-(1-hydroxycyclohexa-2,4-dien-1-yl)-6,9a-dimethyl-3-methylidene-4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan-2,9-dione |
|---|---|
| PubChem CID | 143871846 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 6a-hydroxy-8-(1-hydroxycyclohexa-2,4-dien-1-yl)-6,9a-dimethyl-3-methylidene-4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan-2,9-dione |
| SMILES | C=C1C(=O)OC2C1CCC(C)C1(O)C=C(C3(O)C=CC=CC3)C(=O)C21C |
| InChI | InChI=1S/C21H24O5/c1-12-7-8-14-13(2)18(23)26-17(14)19(3)16(22)15(11-21(12,19)25)20(24)9-5-4-6-10-20/h4-6,9,11-12,14,17,24-25H,2,7-8,10H2,1,3H3 |
| InChIKey | IVFUZMGNUGCNKB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|