About 4,5-diamino-2-methyl-4,5-dihydro-1,3-oxazin-6-one
4,5-diamino-2-methyl-4,5-dihydro-1,3-oxazin-6-one (PubChem CID 143871919) has the molecular formula C5H9N3O2
and a molecular weight of 143.15 g/mol. Its IUPAC name is 4,5-diamino-2-methyl-4,5-dihydro-1,3-oxazin-6-one.
Molecular Properties
| Compound Name | 4,5-diamino-2-methyl-4,5-dihydro-1,3-oxazin-6-one |
| PubChem CID | 143871919 |
| Molecular Formula | C5H9N3O2 |
| Molecular Weight | 143.15 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | 4,5-diamino-2-methyl-4,5-dihydro-1,3-oxazin-6-one |
| SMILES | CC1=NC(N)C(N)C(=O)O1 |
| InChI | InChI=1S/C5H9N3O2/c1-2-8-4(7)3(6)5(9)10-2/h3-4H,6-7H2,1H3 |
| InChIKey | NFSCRHLMPDJVDW-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.15 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,5-diamino-2-methyl-4,5-dihydro-1,3-oxazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-diamino-2-methyl-4,5-dihydro-1,3-oxazin-6-one?
The IUPAC name of 4,5-diamino-2-methyl-4,5-dihydro-1,3-oxazin-6-one (CID 143871919) is 4,5-diamino-2-methyl-4,5-dihydro-1,3-oxazin-6-one.
What is the SMILES notation for 4,5-diamino-2-methyl-4,5-dihydro-1,3-oxazin-6-one?
The canonical SMILES for 4,5-diamino-2-methyl-4,5-dihydro-1,3-oxazin-6-one is CC1=NC(N)C(N)C(=O)O1.
What is the InChIKey of 4,5-diamino-2-methyl-4,5-dihydro-1,3-oxazin-6-one?
The InChIKey is NFSCRHLMPDJVDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3O2/c1-2-8-4(7)3(6)5(9)10-2/h3-4H,6-7H2,1H3.
What are the key properties of 4,5-diamino-2-methyl-4,5-dihydro-1,3-oxazin-6-one?
4,5-diamino-2-methyl-4,5-dihydro-1,3-oxazin-6-one has a molecular weight of 143.15 g/mol, XLogP of -1.43, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diamino-2-methyl-4,5-dihydro-1,3-oxazin-6-one is sourced from PubChem (CID 143871919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).