C20H15F2N3OS — CID 143873039
N-(aminomethylidene)-N'-(2,4-difluorophenyl)-4,5-dihydrothieno[3,2-d][1]benzoxepine-2-carboximidamide (PubChem CID 143873039) has the molecular formula C20H15F2N3OS and a molecular weight of 383.42 g/mol. Its IUPAC name is N-(aminomethylidene)-N'-(2,4-difluorophenyl)-4,5-dihydrothieno[3,2-d][1]benzoxepine-2-carboximidamide.
| Compound Name | N-(aminomethylidene)-N'-(2,4-difluorophenyl)-4,5-dihydrothieno[3,2-d][1]benzoxepine-2-carboximidamide |
|---|---|
| PubChem CID | 143873039 |
| Molecular Formula | C20H15F2N3OS |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | N-(aminomethylidene)-N'-(2,4-difluorophenyl)-4,5-dihydrothieno[3,2-d][1]benzoxepine-2-carboximidamide |
| SMILES | N/C=N/C(=N\c1ccc(F)cc1F)c1cc2c(s1)-c1ccccc1OCC2 |
| InChI | InChI=1S/C20H15F2N3OS/c21-13-5-6-16(15(22)10-13)25-20(24-11-23)18-9-12-7-8-26-17-4-2-1-3-14(17)19(12)27-18/h1-6,9-11H,7-8H2,(H2,23,24,25) |
| InChIKey | PKGUMSUIXKUHRY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|