About (3E)-5-methoxyhexa-1,3,5-trien-3-amine
(3E)-5-methoxyhexa-1,3,5-trien-3-amine (PubChem CID 143873074) has the molecular formula C7H11NO
and a molecular weight of 125.17 g/mol. Its IUPAC name is (3E)-5-methoxyhexa-1,3,5-trien-3-amine.
Molecular Properties
| Compound Name | (3E)-5-methoxyhexa-1,3,5-trien-3-amine |
| PubChem CID | 143873074 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | (3E)-5-methoxyhexa-1,3,5-trien-3-amine |
| SMILES | C=C/C(N)=C\C(=C)OC |
| InChI | InChI=1S/C7H11NO/c1-4-7(8)5-6(2)9-3/h4-5H,1-2,8H2,3H3/b7-5+ |
| InChIKey | NTLHQDYUUKXLDQ-FNORWQNLSA-N |
| XLogP | 1.18 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-5-methoxyhexa-1,3,5-trien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-5-methoxyhexa-1,3,5-trien-3-amine?
The IUPAC name of (3E)-5-methoxyhexa-1,3,5-trien-3-amine (CID 143873074) is (3E)-5-methoxyhexa-1,3,5-trien-3-amine.
What is the SMILES notation for (3E)-5-methoxyhexa-1,3,5-trien-3-amine?
The canonical SMILES for (3E)-5-methoxyhexa-1,3,5-trien-3-amine is C=C/C(N)=C\C(=C)OC.
What is the InChIKey of (3E)-5-methoxyhexa-1,3,5-trien-3-amine?
The InChIKey is NTLHQDYUUKXLDQ-FNORWQNLSA-N. The full InChI is InChI=1S/C7H11NO/c1-4-7(8)5-6(2)9-3/h4-5H,1-2,8H2,3H3/b7-5+.
What are the key properties of (3E)-5-methoxyhexa-1,3,5-trien-3-amine?
(3E)-5-methoxyhexa-1,3,5-trien-3-amine has a molecular weight of 125.17 g/mol, XLogP of 1.18, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-5-methoxyhexa-1,3,5-trien-3-amine is sourced from PubChem (CID 143873074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).