About 9-chloro-6H-[1]benzofuro[2,3-b]quinolin-11-one
9-chloro-6H-[1]benzofuro[2,3-b]quinolin-11-one (PubChem CID 14387312) has the molecular formula C15H8ClNO2
and a molecular weight of 269.69 g/mol. Its IUPAC name is 9-chloro-6H-[1]benzofuro[2,3-b]quinolin-11-one.
Molecular Properties
| Compound Name | 9-chloro-6H-[1]benzofuro[2,3-b]quinolin-11-one |
| PubChem CID | 14387312 |
| Molecular Formula | C15H8ClNO2 |
| Molecular Weight | 269.69 g/mol |
| Exact Mass | 269.02 |
| IUPAC Name | 9-chloro-6H-[1]benzofuro[2,3-b]quinolin-11-one |
| SMILES | O=c1c2cc(Cl)ccc2[nH]c2oc3ccccc3c12 |
| InChI | InChI=1S/C15H8ClNO2/c16-8-5-6-11-10(7-8)14(18)13-9-3-1-2-4-12(9)19-15(13)17-11/h1-7H,(H,17,18) |
| InChIKey | YARRWRGFGLDHGR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.69 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-chloro-6H-[1]benzofuro[2,3-b]quinolin-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-chloro-6H-[1]benzofuro[2,3-b]quinolin-11-one?
The IUPAC name of 9-chloro-6H-[1]benzofuro[2,3-b]quinolin-11-one (CID 14387312) is 9-chloro-6H-[1]benzofuro[2,3-b]quinolin-11-one.
What is the SMILES notation for 9-chloro-6H-[1]benzofuro[2,3-b]quinolin-11-one?
The canonical SMILES for 9-chloro-6H-[1]benzofuro[2,3-b]quinolin-11-one is O=c1c2cc(Cl)ccc2[nH]c2oc3ccccc3c12.
What is the InChIKey of 9-chloro-6H-[1]benzofuro[2,3-b]quinolin-11-one?
The InChIKey is YARRWRGFGLDHGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8ClNO2/c16-8-5-6-11-10(7-8)14(18)13-9-3-1-2-4-12(9)19-15(13)17-11/h1-7H,(H,17,18).
What are the key properties of 9-chloro-6H-[1]benzofuro[2,3-b]quinolin-11-one?
9-chloro-6H-[1]benzofuro[2,3-b]quinolin-11-one has a molecular weight of 269.69 g/mol, XLogP of 4.08, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-chloro-6H-[1]benzofuro[2,3-b]quinolin-11-one is sourced from PubChem (CID 14387312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).