C30H39FO2 — CID 143873270
ethane;4-[(1E,3E,5E)-6-(3-fluorophenyl)-3-methylocta-1,3,5,7-tetraenyl]-3-methyl-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-3H-benzo[f][2]benzofuran-1-one (PubChem CID 143873270) has the molecular formula C30H39FO2 and a molecular weight of 450.64 g/mol. Its IUPAC name is ethane;4-[(1E,3E,5E)-6-(3-fluorophenyl)-3-methylocta-1,3,5,7-tetraenyl]-3-methyl-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-3H-benzo[f][2]benzofuran-1-one.
| Compound Name | ethane;4-[(1E,3E,5E)-6-(3-fluorophenyl)-3-methylocta-1,3,5,7-tetraenyl]-3-methyl-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-3H-benzo[f][2]benzofuran-1-one |
|---|---|
| PubChem CID | 143873270 |
| Molecular Formula | C30H39FO2 |
| Molecular Weight | 450.64 g/mol |
| Exact Mass | 450.29 |
| IUPAC Name | ethane;4-[(1E,3E,5E)-6-(3-fluorophenyl)-3-methylocta-1,3,5,7-tetraenyl]-3-methyl-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-3H-benzo[f][2]benzofuran-1-one |
| SMILES | C=C/C(=C\C=C(C)\C=C\C1C2CCCCC2CC2C(=O)OC(C)C21)c1cccc(F)c1.CC |
| InChI | InChI=1S/C28H33FO2.C2H6/c1-4-20(21-9-7-10-23(29)16-21)14-12-18(2)13-15-25-24-11-6-5-8-22(24)17-26-27(25)19(3)31-28(26)30;1-2/h4,7,9-10,12-16,19,22,24-27H,1,5-6,8,11,17H2,2-3H3;1-2H3/b15-13+,18-12+,20-14+; |
| InChIKey | QVTHFXNBWIOBRV-YQVYSMDHSA-N |
| XLogP | 7.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.64 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|