About 1-[2-(diethylamino)cyclohexa-1,5-dien-1-yl]ethanone;ethane
1-[2-(diethylamino)cyclohexa-1,5-dien-1-yl]ethanone;ethane (PubChem CID 143873374) has the molecular formula C14H25NO
and a molecular weight of 223.36 g/mol. Its IUPAC name is 1-[2-(diethylamino)cyclohexa-1,5-dien-1-yl]ethanone;ethane.
Molecular Properties
| Compound Name | 1-[2-(diethylamino)cyclohexa-1,5-dien-1-yl]ethanone;ethane |
| PubChem CID | 143873374 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | 1-[2-(diethylamino)cyclohexa-1,5-dien-1-yl]ethanone;ethane |
| SMILES | CC.CCN(CC)C1=C(C(C)=O)C=CCC1 |
| InChI | InChI=1S/C12H19NO.C2H6/c1-4-13(5-2)12-9-7-6-8-11(12)10(3)14;1-2/h6,8H,4-5,7,9H2,1-3H3;1-2H3 |
| InChIKey | XDBVWPOIGVIBEK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[2-(diethylamino)cyclohexa-1,5-dien-1-yl]ethanone;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(diethylamino)cyclohexa-1,5-dien-1-yl]ethanone;ethane?
The IUPAC name of 1-[2-(diethylamino)cyclohexa-1,5-dien-1-yl]ethanone;ethane (CID 143873374) is 1-[2-(diethylamino)cyclohexa-1,5-dien-1-yl]ethanone;ethane.
What is the SMILES notation for 1-[2-(diethylamino)cyclohexa-1,5-dien-1-yl]ethanone;ethane?
The canonical SMILES for 1-[2-(diethylamino)cyclohexa-1,5-dien-1-yl]ethanone;ethane is CC.CCN(CC)C1=C(C(C)=O)C=CCC1.
What is the InChIKey of 1-[2-(diethylamino)cyclohexa-1,5-dien-1-yl]ethanone;ethane?
The InChIKey is XDBVWPOIGVIBEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO.C2H6/c1-4-13(5-2)12-9-7-6-8-11(12)10(3)14;1-2/h6,8H,4-5,7,9H2,1-3H3;1-2H3.
What are the key properties of 1-[2-(diethylamino)cyclohexa-1,5-dien-1-yl]ethanone;ethane?
1-[2-(diethylamino)cyclohexa-1,5-dien-1-yl]ethanone;ethane has a molecular weight of 223.36 g/mol, XLogP of 3.55, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(diethylamino)cyclohexa-1,5-dien-1-yl]ethanone;ethane is sourced from PubChem (CID 143873374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).