C18H16F3NO4S — CID 143874014
2-[[4-[2-(trifluoromethyl)phenyl]sulfanyl-2,3-dihydro-1,4-benzoxazin-3-yl]methoxy]acetic acid (PubChem CID 143874014) has the molecular formula C18H16F3NO4S and a molecular weight of 399.39 g/mol. Its IUPAC name is 2-[[4-[2-(trifluoromethyl)phenyl]sulfanyl-2,3-dihydro-1,4-benzoxazin-3-yl]methoxy]acetic acid.
| Compound Name | 2-[[4-[2-(trifluoromethyl)phenyl]sulfanyl-2,3-dihydro-1,4-benzoxazin-3-yl]methoxy]acetic acid |
|---|---|
| PubChem CID | 143874014 |
| Molecular Formula | C18H16F3NO4S |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 2-[[4-[2-(trifluoromethyl)phenyl]sulfanyl-2,3-dihydro-1,4-benzoxazin-3-yl]methoxy]acetic acid |
| SMILES | O=C(O)COCC1COc2ccccc2N1Sc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H16F3NO4S/c19-18(20,21)13-5-1-4-8-16(13)27-22-12(9-25-11-17(23)24)10-26-15-7-3-2-6-14(15)22/h1-8,12H,9-11H2,(H,23,24) |
| InChIKey | UAIJIFXGLHCSGX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|