C16H28N2 — CID 143874803
(4aS)-6-(cyclohexa-1,5-dien-1-ylmethyl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine;ethane (PubChem CID 143874803) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is (4aS)-6-(cyclohexa-1,5-dien-1-ylmethyl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine;ethane.
| Compound Name | (4aS)-6-(cyclohexa-1,5-dien-1-ylmethyl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine;ethane |
|---|---|
| PubChem CID | 143874803 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | (4aS)-6-(cyclohexa-1,5-dien-1-ylmethyl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine;ethane |
| SMILES | C1=CC(CN2CC3NCCC[C@H]3C2)=CCC1.CC |
| InChI | InChI=1S/C14H22N2.C2H6/c1-2-5-12(6-3-1)9-16-10-13-7-4-8-15-14(13)11-16;1-2/h2,5-6,13-15H,1,3-4,7-11H2;1-2H3/t13-,14?;/m0./s1 |
| InChIKey | ROZZRLMOWYRUIK-GPFYXIAXSA-N |
| XLogP | 2.97 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |