C20H24N2O2 — CID 143875536
1-[[(1S,2S)-2-ethenylcyclohexyl]methyl]-2,3-dihydro-[1,4]oxazino[2,3-c]quinolin-9-ol (PubChem CID 143875536) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 1-[[(1S,2S)-2-ethenylcyclohexyl]methyl]-2,3-dihydro-[1,4]oxazino[2,3-c]quinolin-9-ol.
| Compound Name | 1-[[(1S,2S)-2-ethenylcyclohexyl]methyl]-2,3-dihydro-[1,4]oxazino[2,3-c]quinolin-9-ol |
|---|---|
| PubChem CID | 143875536 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 1-[[(1S,2S)-2-ethenylcyclohexyl]methyl]-2,3-dihydro-[1,4]oxazino[2,3-c]quinolin-9-ol |
| SMILES | C=C[C@@H]1CCCC[C@@H]1CN1CCOc2cnc3ccc(O)cc3c21 |
| InChI | InChI=1S/C20H24N2O2/c1-2-14-5-3-4-6-15(14)13-22-9-10-24-19-12-21-18-8-7-16(23)11-17(18)20(19)22/h2,7-8,11-12,14-15,23H,1,3-6,9-10,13H2/t14-,15-/m1/s1 |
| InChIKey | IDGUZBPNTDHVEI-HUUCEWRRSA-N |
| XLogP | 4.13 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|