About 4-aminophenol;2,3-dimethylideneoxane
4-aminophenol;2,3-dimethylideneoxane (PubChem CID 143875727) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is 4-aminophenol;2,3-dimethylideneoxane.
Molecular Properties
| Compound Name | 4-aminophenol;2,3-dimethylideneoxane |
| PubChem CID | 143875727 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 4-aminophenol;2,3-dimethylideneoxane |
| SMILES | C=C1CCCOC1=C.Nc1ccc(O)cc1 |
| InChI | InChI=1S/C7H10O.C6H7NO/c1-6-4-3-5-8-7(6)2;7-5-1-3-6(8)4-2-5/h1-5H2;1-4,8H,7H2 |
| InChIKey | VDNCQKWYDMWOLN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-aminophenol;2,3-dimethylideneoxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminophenol;2,3-dimethylideneoxane?
The IUPAC name of 4-aminophenol;2,3-dimethylideneoxane (CID 143875727) is 4-aminophenol;2,3-dimethylideneoxane.
What is the SMILES notation for 4-aminophenol;2,3-dimethylideneoxane?
The canonical SMILES for 4-aminophenol;2,3-dimethylideneoxane is C=C1CCCOC1=C.Nc1ccc(O)cc1.
What is the InChIKey of 4-aminophenol;2,3-dimethylideneoxane?
The InChIKey is VDNCQKWYDMWOLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O.C6H7NO/c1-6-4-3-5-8-7(6)2;7-5-1-3-6(8)4-2-5/h1-5H2;1-4,8H,7H2.
What are the key properties of 4-aminophenol;2,3-dimethylideneoxane?
4-aminophenol;2,3-dimethylideneoxane has a molecular weight of 219.28 g/mol, XLogP of 2.84, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminophenol;2,3-dimethylideneoxane is sourced from PubChem (CID 143875727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).