About tert-butyl 2-acetyl-4-(2-hydroxyethyl)piperidine-1-carboxylate;propane
tert-butyl 2-acetyl-4-(2-hydroxyethyl)piperidine-1-carboxylate;propane (PubChem CID 143876026) has the molecular formula C17H33NO4
and a molecular weight of 315.45 g/mol. Its IUPAC name is tert-butyl 2-acetyl-4-(2-hydroxyethyl)piperidine-1-carboxylate;propane.
Molecular Properties
| Compound Name | tert-butyl 2-acetyl-4-(2-hydroxyethyl)piperidine-1-carboxylate;propane |
| PubChem CID | 143876026 |
| Molecular Formula | C17H33NO4 |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | tert-butyl 2-acetyl-4-(2-hydroxyethyl)piperidine-1-carboxylate;propane |
| SMILES | CC(=O)C1CC(CCO)CCN1C(=O)OC(C)(C)C.CCC |
| InChI | InChI=1S/C14H25NO4.C3H8/c1-10(17)12-9-11(6-8-16)5-7-15(12)13(18)19-14(2,3)4;1-3-2/h11-12,16H,5-9H2,1-4H3;3H2,1-2H3 |
| InChIKey | YMCGDZKFIKFQDT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 2-acetyl-4-(2-hydroxyethyl)piperidine-1-carboxylate;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-acetyl-4-(2-hydroxyethyl)piperidine-1-carboxylate;propane?
The IUPAC name of tert-butyl 2-acetyl-4-(2-hydroxyethyl)piperidine-1-carboxylate;propane (CID 143876026) is tert-butyl 2-acetyl-4-(2-hydroxyethyl)piperidine-1-carboxylate;propane.
What is the SMILES notation for tert-butyl 2-acetyl-4-(2-hydroxyethyl)piperidine-1-carboxylate;propane?
The canonical SMILES for tert-butyl 2-acetyl-4-(2-hydroxyethyl)piperidine-1-carboxylate;propane is CC(=O)C1CC(CCO)CCN1C(=O)OC(C)(C)C.CCC.
What is the InChIKey of tert-butyl 2-acetyl-4-(2-hydroxyethyl)piperidine-1-carboxylate;propane?
The InChIKey is YMCGDZKFIKFQDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO4.C3H8/c1-10(17)12-9-11(6-8-16)5-7-15(12)13(18)19-14(2,3)4;1-3-2/h11-12,16H,5-9H2,1-4H3;3H2,1-2H3.
What are the key properties of tert-butyl 2-acetyl-4-(2-hydroxyethyl)piperidine-1-carboxylate;propane?
tert-butyl 2-acetyl-4-(2-hydroxyethyl)piperidine-1-carboxylate;propane has a molecular weight of 315.45 g/mol, XLogP of 3.39, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-acetyl-4-(2-hydroxyethyl)piperidine-1-carboxylate;propane is sourced from PubChem (CID 143876026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).