About 4-butoxy-1-methylpiperidine;ethane;4-(3-methoxypropyl)-1-methylpiperidine
4-butoxy-1-methylpiperidine;ethane;4-(3-methoxypropyl)-1-methylpiperidine (PubChem CID 143876376) has the molecular formula C22H48N2O2
and a molecular weight of 372.64 g/mol. Its IUPAC name is 4-butoxy-1-methylpiperidine;ethane;4-(3-methoxypropyl)-1-methylpiperidine.
Molecular Properties
| Compound Name | 4-butoxy-1-methylpiperidine;ethane;4-(3-methoxypropyl)-1-methylpiperidine |
| PubChem CID | 143876376 |
| Molecular Formula | C22H48N2O2 |
| Molecular Weight | 372.64 g/mol |
| Exact Mass | 372.37 |
| IUPAC Name | 4-butoxy-1-methylpiperidine;ethane;4-(3-methoxypropyl)-1-methylpiperidine |
| SMILES | CC.CCCCOC1CCN(C)CC1.COCCCC1CCN(C)CC1 |
| InChI | InChI=1S/2C10H21NO.C2H6/c1-11-7-5-10(6-8-11)4-3-9-12-2;1-3-4-9-12-10-5-7-11(2)8-6-10;1-2/h2*10H,3-9H2,1-2H3;1-2H3 |
| InChIKey | VGNNYWSWVJNAPR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.64 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-butoxy-1-methylpiperidine;ethane;4-(3-methoxypropyl)-1-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butoxy-1-methylpiperidine;ethane;4-(3-methoxypropyl)-1-methylpiperidine?
The IUPAC name of 4-butoxy-1-methylpiperidine;ethane;4-(3-methoxypropyl)-1-methylpiperidine (CID 143876376) is 4-butoxy-1-methylpiperidine;ethane;4-(3-methoxypropyl)-1-methylpiperidine.
What is the SMILES notation for 4-butoxy-1-methylpiperidine;ethane;4-(3-methoxypropyl)-1-methylpiperidine?
The canonical SMILES for 4-butoxy-1-methylpiperidine;ethane;4-(3-methoxypropyl)-1-methylpiperidine is CC.CCCCOC1CCN(C)CC1.COCCCC1CCN(C)CC1.
What is the InChIKey of 4-butoxy-1-methylpiperidine;ethane;4-(3-methoxypropyl)-1-methylpiperidine?
The InChIKey is VGNNYWSWVJNAPR-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H21NO.C2H6/c1-11-7-5-10(6-8-11)4-3-9-12-2;1-3-4-9-12-10-5-7-11(2)8-6-10;1-2/h2*10H,3-9H2,1-2H3;1-2H3.
What are the key properties of 4-butoxy-1-methylpiperidine;ethane;4-(3-methoxypropyl)-1-methylpiperidine?
4-butoxy-1-methylpiperidine;ethane;4-(3-methoxypropyl)-1-methylpiperidine has a molecular weight of 372.64 g/mol, XLogP of 4.68, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butoxy-1-methylpiperidine;ethane;4-(3-methoxypropyl)-1-methylpiperidine is sourced from PubChem (CID 143876376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).