C25H25N5O5 — CID 143877288
(2R)-2-[(E)-2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]ethenyl]-4-methylidenepentanedioic acid (PubChem CID 143877288) has the molecular formula C25H25N5O5 and a molecular weight of 475.51 g/mol. Its IUPAC name is (2R)-2-[(E)-2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]ethenyl]-4-methylidenepentanedioic acid.
| Compound Name | (2R)-2-[(E)-2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]ethenyl]-4-methylidenepentanedioic acid |
|---|---|
| PubChem CID | 143877288 |
| Molecular Formula | C25H25N5O5 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | (2R)-2-[(E)-2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]ethenyl]-4-methylidenepentanedioic acid |
| SMILES | C=C(C[C@H](/C=C/NC(=O)c1ccc(CCc2ccc3nc(N)nc(N)c3c2)cc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C25H25N5O5/c1-14(23(32)33)12-18(24(34)35)10-11-28-22(31)17-7-4-15(5-8-17)2-3-16-6-9-20-19(13-16)21(26)30-25(27)29-20/h4-11,13,18H,1-3,12H2,(H,28,31)(H,32,33)(H,34,35)(H4,26,27,29,30)/b11-10+/t18-/m0/s1 |
| InChIKey | PPABKASWIOBFGU-ZGKFYVQTSA-N |
| XLogP | 2.55 |
| TPSA | 181.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|