C22H23N5O2S — CID 143877417
1-[3-(1H-indol-4-ylsulfanylamino)-4-oxo-4-(4-oxopiperidin-1-yl)butyl]pyrrole-2-carbonitrile (PubChem CID 143877417) has the molecular formula C22H23N5O2S and a molecular weight of 421.53 g/mol. Its IUPAC name is 1-[3-(1H-indol-4-ylsulfanylamino)-4-oxo-4-(4-oxopiperidin-1-yl)butyl]pyrrole-2-carbonitrile.
| Compound Name | 1-[3-(1H-indol-4-ylsulfanylamino)-4-oxo-4-(4-oxopiperidin-1-yl)butyl]pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 143877417 |
| Molecular Formula | C22H23N5O2S |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 1-[3-(1H-indol-4-ylsulfanylamino)-4-oxo-4-(4-oxopiperidin-1-yl)butyl]pyrrole-2-carbonitrile |
| SMILES | N#Cc1cccn1CCC(NSc1cccc2[nH]ccc12)C(=O)N1CCC(=O)CC1 |
| InChI | InChI=1S/C22H23N5O2S/c23-15-16-3-2-11-26(16)14-9-20(22(29)27-12-7-17(28)8-13-27)25-30-21-5-1-4-19-18(21)6-10-24-19/h1-6,10-11,20,24-25H,7-9,12-14H2 |
| InChIKey | BLWHDWKMACYIPT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 93.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|