C14H21N — CID 14387761
1,2,2,4,6-pentamethyl-3,4-dihydroquinoline (PubChem CID 14387761) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 1,2,2,4,6-pentamethyl-3,4-dihydroquinoline.
| Compound Name | 1,2,2,4,6-pentamethyl-3,4-dihydroquinoline |
|---|---|
| PubChem CID | 14387761 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 1,2,2,4,6-pentamethyl-3,4-dihydroquinoline |
| SMILES | Cc1ccc2c(c1)C(C)CC(C)(C)N2C |
| InChI | InChI=1S/C14H21N/c1-10-6-7-13-12(8-10)11(2)9-14(3,4)15(13)5/h6-8,11H,9H2,1-5H3 |
| InChIKey | GVPHCIOBUQZDKU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |