C29H28ClN5OS — CID 143877645
2-[(2-chloro-6-methylphenyl)sulfanylamino]-4-(2-cyanopyrrol-1-yl)-N-methyl-N-[(3-pyridin-3-ylphenyl)methyl]butanamide (PubChem CID 143877645) has the molecular formula C29H28ClN5OS and a molecular weight of 530.10 g/mol. Its IUPAC name is 2-[(2-chloro-6-methylphenyl)sulfanylamino]-4-(2-cyanopyrrol-1-yl)-N-methyl-N-[(3-pyridin-3-ylphenyl)methyl]butanamide.
| Compound Name | 2-[(2-chloro-6-methylphenyl)sulfanylamino]-4-(2-cyanopyrrol-1-yl)-N-methyl-N-[(3-pyridin-3-ylphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 143877645 |
| Molecular Formula | C29H28ClN5OS |
| Molecular Weight | 530.10 g/mol |
| Exact Mass | 529.17 |
| IUPAC Name | 2-[(2-chloro-6-methylphenyl)sulfanylamino]-4-(2-cyanopyrrol-1-yl)-N-methyl-N-[(3-pyridin-3-ylphenyl)methyl]butanamide |
| SMILES | Cc1cccc(Cl)c1SNC(CCn1cccc1C#N)C(=O)N(C)Cc1cccc(-c2cccnc2)c1 |
| InChI | InChI=1S/C29H28ClN5OS/c1-21-7-3-12-26(30)28(21)37-33-27(13-16-35-15-6-11-25(35)18-31)29(36)34(2)20-22-8-4-9-23(17-22)24-10-5-14-32-19-24/h3-12,14-15,17,19,27,33H,13,16,20H2,1-2H3 |
| InChIKey | GXTLJJWVWNCBEV-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 73.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.10 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|