About benzene;2-(4-bromo-3-fluorophenyl)-1,3-dioxane
benzene;2-(4-bromo-3-fluorophenyl)-1,3-dioxane (PubChem CID 143877741) has the molecular formula C16H16BrFO2
and a molecular weight of 339.20 g/mol. Its IUPAC name is benzene;2-(4-bromo-3-fluorophenyl)-1,3-dioxane.
Molecular Properties
| Compound Name | benzene;2-(4-bromo-3-fluorophenyl)-1,3-dioxane |
| PubChem CID | 143877741 |
| Molecular Formula | C16H16BrFO2 |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | benzene;2-(4-bromo-3-fluorophenyl)-1,3-dioxane |
| SMILES | Fc1cc(C2OCCCO2)ccc1Br.c1ccccc1 |
| InChI | InChI=1S/C10H10BrFO2.C6H6/c11-8-3-2-7(6-9(8)12)10-13-4-1-5-14-10;1-2-4-6-5-3-1/h2-3,6,10H,1,4-5H2;1-6H |
| InChIKey | QHQMKYQBLYAZFC-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzene;2-(4-bromo-3-fluorophenyl)-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;2-(4-bromo-3-fluorophenyl)-1,3-dioxane?
The IUPAC name of benzene;2-(4-bromo-3-fluorophenyl)-1,3-dioxane (CID 143877741) is benzene;2-(4-bromo-3-fluorophenyl)-1,3-dioxane.
What is the SMILES notation for benzene;2-(4-bromo-3-fluorophenyl)-1,3-dioxane?
The canonical SMILES for benzene;2-(4-bromo-3-fluorophenyl)-1,3-dioxane is Fc1cc(C2OCCCO2)ccc1Br.c1ccccc1.
What is the InChIKey of benzene;2-(4-bromo-3-fluorophenyl)-1,3-dioxane?
The InChIKey is QHQMKYQBLYAZFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrFO2.C6H6/c11-8-3-2-7(6-9(8)12)10-13-4-1-5-14-10;1-2-4-6-5-3-1/h2-3,6,10H,1,4-5H2;1-6H.
What are the key properties of benzene;2-(4-bromo-3-fluorophenyl)-1,3-dioxane?
benzene;2-(4-bromo-3-fluorophenyl)-1,3-dioxane has a molecular weight of 339.20 g/mol, XLogP of 4.71, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;2-(4-bromo-3-fluorophenyl)-1,3-dioxane is sourced from PubChem (CID 143877741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).