About 5,6-dihydro-3H-1,3-benzothiazole-2-thione;ethane
5,6-dihydro-3H-1,3-benzothiazole-2-thione;ethane (PubChem CID 143877893) has the molecular formula C9H13NS2
and a molecular weight of 199.34 g/mol. Its IUPAC name is 5,6-dihydro-3H-1,3-benzothiazole-2-thione;ethane.
Molecular Properties
| Compound Name | 5,6-dihydro-3H-1,3-benzothiazole-2-thione;ethane |
| PubChem CID | 143877893 |
| Molecular Formula | C9H13NS2 |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | 5,6-dihydro-3H-1,3-benzothiazole-2-thione;ethane |
| SMILES | CC.S=c1[nH]c2c(s1)=CCCC=2 |
| InChI | InChI=1S/C7H7NS2.C2H6/c9-7-8-5-3-1-2-4-6(5)10-7;1-2/h3-4H,1-2H2,(H,8,9);1-2H3 |
| InChIKey | RESYAFBILDKWRR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dihydro-3H-1,3-benzothiazole-2-thione;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydro-3H-1,3-benzothiazole-2-thione;ethane?
The IUPAC name of 5,6-dihydro-3H-1,3-benzothiazole-2-thione;ethane (CID 143877893) is 5,6-dihydro-3H-1,3-benzothiazole-2-thione;ethane.
What is the SMILES notation for 5,6-dihydro-3H-1,3-benzothiazole-2-thione;ethane?
The canonical SMILES for 5,6-dihydro-3H-1,3-benzothiazole-2-thione;ethane is CC.S=c1[nH]c2c(s1)=CCCC=2.
What is the InChIKey of 5,6-dihydro-3H-1,3-benzothiazole-2-thione;ethane?
The InChIKey is RESYAFBILDKWRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NS2.C2H6/c9-7-8-5-3-1-2-4-6(5)10-7;1-2/h3-4H,1-2H2,(H,8,9);1-2H3.
What are the key properties of 5,6-dihydro-3H-1,3-benzothiazole-2-thione;ethane?
5,6-dihydro-3H-1,3-benzothiazole-2-thione;ethane has a molecular weight of 199.34 g/mol, XLogP of 2.19, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydro-3H-1,3-benzothiazole-2-thione;ethane is sourced from PubChem (CID 143877893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).