About [4-[(6,7-dimethoxyquinolin-4-yl)methyl]-3-methylanilino] formate;1-methyl-3-phenylbenzene
[4-[(6,7-dimethoxyquinolin-4-yl)methyl]-3-methylanilino] formate;1-methyl-3-phenylbenzene (PubChem CID 143878356) has the molecular formula C33H32N2O4
and a molecular weight of 520.63 g/mol. Its IUPAC name is [4-[(6,7-dimethoxyquinolin-4-yl)methyl]-3-methylanilino] formate;1-methyl-3-phenylbenzene.
Molecular Properties
| Compound Name | [4-[(6,7-dimethoxyquinolin-4-yl)methyl]-3-methylanilino] formate;1-methyl-3-phenylbenzene |
| PubChem CID | 143878356 |
| Molecular Formula | C33H32N2O4 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | [4-[(6,7-dimethoxyquinolin-4-yl)methyl]-3-methylanilino] formate;1-methyl-3-phenylbenzene |
| SMILES | COc1cc2nccc(Cc3ccc(NOC=O)cc3C)c2cc1OC.Cc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C20H20N2O4.C13H12/c1-13-8-16(22-26-12-23)5-4-14(13)9-15-6-7-21-18-11-20(25-3)19(24-2)10-17(15)18;1-11-6-5-9-13(10-11)12-7-3-2-4-8-12/h4-8,10-12,22H,9H2,1-3H3;2-10H,1H3 |
| InChIKey | BVBCONOOCANBOP-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-[(6,7-dimethoxyquinolin-4-yl)methyl]-3-methylanilino] formate;1-methyl-3-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(6,7-dimethoxyquinolin-4-yl)methyl]-3-methylanilino] formate;1-methyl-3-phenylbenzene?
The IUPAC name of [4-[(6,7-dimethoxyquinolin-4-yl)methyl]-3-methylanilino] formate;1-methyl-3-phenylbenzene (CID 143878356) is [4-[(6,7-dimethoxyquinolin-4-yl)methyl]-3-methylanilino] formate;1-methyl-3-phenylbenzene.
What is the SMILES notation for [4-[(6,7-dimethoxyquinolin-4-yl)methyl]-3-methylanilino] formate;1-methyl-3-phenylbenzene?
The canonical SMILES for [4-[(6,7-dimethoxyquinolin-4-yl)methyl]-3-methylanilino] formate;1-methyl-3-phenylbenzene is COc1cc2nccc(Cc3ccc(NOC=O)cc3C)c2cc1OC.Cc1cccc(-c2ccccc2)c1.
What is the InChIKey of [4-[(6,7-dimethoxyquinolin-4-yl)methyl]-3-methylanilino] formate;1-methyl-3-phenylbenzene?
The InChIKey is BVBCONOOCANBOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O4.C13H12/c1-13-8-16(22-26-12-23)5-4-14(13)9-15-6-7-21-18-11-20(25-3)19(24-2)10-17(15)18;1-11-6-5-9-13(10-11)12-7-3-2-4-8-12/h4-8,10-12,22H,9H2,1-3H3;2-10H,1H3.
What are the key properties of [4-[(6,7-dimethoxyquinolin-4-yl)methyl]-3-methylanilino] formate;1-methyl-3-phenylbenzene?
[4-[(6,7-dimethoxyquinolin-4-yl)methyl]-3-methylanilino] formate;1-methyl-3-phenylbenzene has a molecular weight of 520.63 g/mol, XLogP of 7.31, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(6,7-dimethoxyquinolin-4-yl)methyl]-3-methylanilino] formate;1-methyl-3-phenylbenzene is sourced from PubChem (CID 143878356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).