C26H34F2N4O4 — CID 143878582
(2S)-3-cyclohexyl-2-[3-(2,3-difluorophenoxy)-5-oxo-2H-pyrrol-1-yl]-N-[(Z)-3-[(2-hydroxy-2-methylpropyl)amino]prop-2-enimidoyl]propanamide (PubChem CID 143878582) has the molecular formula C26H34F2N4O4 and a molecular weight of 504.58 g/mol. Its IUPAC name is (2S)-3-cyclohexyl-2-[3-(2,3-difluorophenoxy)-5-oxo-2H-pyrrol-1-yl]-N-[(Z)-3-[(2-hydroxy-2-methylpropyl)amino]prop-2-enimidoyl]propanamide.
| Compound Name | (2S)-3-cyclohexyl-2-[3-(2,3-difluorophenoxy)-5-oxo-2H-pyrrol-1-yl]-N-[(Z)-3-[(2-hydroxy-2-methylpropyl)amino]prop-2-enimidoyl]propanamide |
|---|---|
| PubChem CID | 143878582 |
| Molecular Formula | C26H34F2N4O4 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | (2S)-3-cyclohexyl-2-[3-(2,3-difluorophenoxy)-5-oxo-2H-pyrrol-1-yl]-N-[(Z)-3-[(2-hydroxy-2-methylpropyl)amino]prop-2-enimidoyl]propanamide |
| SMILES | [H]/N=C(\C=C/NCC(C)(C)O)NC(=O)[C@H](CC1CCCCC1)N1CC(Oc2cccc(F)c2F)=CC1=O |
| InChI | InChI=1S/C26H34F2N4O4/c1-26(2,35)16-30-12-11-22(29)31-25(34)20(13-17-7-4-3-5-8-17)32-15-18(14-23(32)33)36-21-10-6-9-19(27)24(21)28/h6,9-12,14,17,20,30,35H,3-5,7-8,13,15-16H2,1-2H3,(H2,29,31,34)/b12-11-/t20-/m0/s1 |
| InChIKey | VVXUWXLFOHBVRJ-DUQGCJEPSA-N |
| XLogP | 3.38 |
| TPSA | 114.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|