C25H34F2N4O5 — CID 143878599
(2S)-2-[3-(2,6-difluoro-3-propan-2-yloxyphenoxy)-5-oxo-2H-pyrrol-1-yl]-N-[(Z)-3-(3-hydroxypropylamino)prop-2-enimidoyl]-4-methylpentanamide (PubChem CID 143878599) has the molecular formula C25H34F2N4O5 and a molecular weight of 508.57 g/mol. Its IUPAC name is (2S)-2-[3-(2,6-difluoro-3-propan-2-yloxyphenoxy)-5-oxo-2H-pyrrol-1-yl]-N-[(Z)-3-(3-hydroxypropylamino)prop-2-enimidoyl]-4-methylpentanamide.
| Compound Name | (2S)-2-[3-(2,6-difluoro-3-propan-2-yloxyphenoxy)-5-oxo-2H-pyrrol-1-yl]-N-[(Z)-3-(3-hydroxypropylamino)prop-2-enimidoyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 143878599 |
| Molecular Formula | C25H34F2N4O5 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | (2S)-2-[3-(2,6-difluoro-3-propan-2-yloxyphenoxy)-5-oxo-2H-pyrrol-1-yl]-N-[(Z)-3-(3-hydroxypropylamino)prop-2-enimidoyl]-4-methylpentanamide |
| SMILES | [H]/N=C(\C=C/NCCCO)NC(=O)[C@H](CC(C)C)N1CC(Oc2c(F)ccc(OC(C)C)c2F)=CC1=O |
| InChI | InChI=1S/C25H34F2N4O5/c1-15(2)12-19(25(34)30-21(28)8-10-29-9-5-11-32)31-14-17(13-22(31)33)36-24-18(26)6-7-20(23(24)27)35-16(3)4/h6-8,10,13,15-16,19,29,32H,5,9,11-12,14H2,1-4H3,(H2,28,30,34)/b10-8-/t19-/m0/s1 |
| InChIKey | WAYHBNYJOIXSDU-QIBOZCLASA-N |
| XLogP | 2.85 |
| TPSA | 123.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|