C24H33FN4O5 — CID 143878681
N-[(Z)-1-amino-3-(3-hydroxypropylamino)prop-2-enylidene]-2-[3-(3-ethoxy-2-fluorophenoxy)-5-oxo-2H-pyrrol-1-yl]-4-methylpentanamide (PubChem CID 143878681) has the molecular formula C24H33FN4O5 and a molecular weight of 476.55 g/mol. Its IUPAC name is N-[(Z)-1-amino-3-(3-hydroxypropylamino)prop-2-enylidene]-2-[3-(3-ethoxy-2-fluorophenoxy)-5-oxo-2H-pyrrol-1-yl]-4-methylpentanamide.
| Compound Name | N-[(Z)-1-amino-3-(3-hydroxypropylamino)prop-2-enylidene]-2-[3-(3-ethoxy-2-fluorophenoxy)-5-oxo-2H-pyrrol-1-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 143878681 |
| Molecular Formula | C24H33FN4O5 |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | N-[(Z)-1-amino-3-(3-hydroxypropylamino)prop-2-enylidene]-2-[3-(3-ethoxy-2-fluorophenoxy)-5-oxo-2H-pyrrol-1-yl]-4-methylpentanamide |
| SMILES | CCOc1cccc(OC2=CC(=O)N(C(CC(C)C)C(=O)/N=C(N)/C=C\NCCCO)C2)c1F |
| InChI | InChI=1S/C24H33FN4O5/c1-4-33-19-7-5-8-20(23(19)25)34-17-14-22(31)29(15-17)18(13-16(2)3)24(32)28-21(26)9-11-27-10-6-12-30/h5,7-9,11,14,16,18,27,30H,4,6,10,12-13,15H2,1-3H3,(H2,26,28,32)/b11-9- |
| InChIKey | CGTILMRWLYFUOC-LUAWRHEFSA-N |
| XLogP | 2.11 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|