C31H41N3O2S — CID 143880617
4,6a,11,11,14b-pentamethyl-8a-(5-methyl-1,3,4-thiadiazol-2-yl)-3,13-dioxo-4,4a,5,6,6a,6b,7,8,9,10,12,12a,14,14a-tetradecahydropicene-2-carbonitrile (PubChem CID 143880617) has the molecular formula C31H41N3O2S and a molecular weight of 519.76 g/mol. Its IUPAC name is 4,6a,11,11,14b-pentamethyl-8a-(5-methyl-1,3,4-thiadiazol-2-yl)-3,13-dioxo-4,4a,5,6,6a,6b,7,8,9,10,12,12a,14,14a-tetradecahydropicene-2-carbonitrile.
| Compound Name | 4,6a,11,11,14b-pentamethyl-8a-(5-methyl-1,3,4-thiadiazol-2-yl)-3,13-dioxo-4,4a,5,6,6a,6b,7,8,9,10,12,12a,14,14a-tetradecahydropicene-2-carbonitrile |
|---|---|
| PubChem CID | 143880617 |
| Molecular Formula | C31H41N3O2S |
| Molecular Weight | 519.76 g/mol |
| Exact Mass | 519.29 |
| IUPAC Name | 4,6a,11,11,14b-pentamethyl-8a-(5-methyl-1,3,4-thiadiazol-2-yl)-3,13-dioxo-4,4a,5,6,6a,6b,7,8,9,10,12,12a,14,14a-tetradecahydropicene-2-carbonitrile |
| SMILES | Cc1nnc(C23CCC4C(C(=O)CC5C6(C)C=C(C#N)C(=O)C(C)C6CCC45C)C2CC(C)(C)CC3)s1 |
| InChI | InChI=1S/C31H41N3O2S/c1-17-20-7-9-29(5)21-8-10-31(27-34-33-18(2)37-27)12-11-28(3,4)15-22(31)25(21)23(35)13-24(29)30(20,6)14-19(16-32)26(17)36/h14,17,20-22,24-25H,7-13,15H2,1-6H3 |
| InChIKey | HIDAECRJZHKUQJ-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 83.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.76 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |