C10H12O2S — CID 14388135
2-phenylsulfanyl-1,3-dioxane (PubChem CID 14388135) has the molecular formula C10H12O2S and a molecular weight of 196.27 g/mol. Its IUPAC name is 2-phenylsulfanyl-1,3-dioxane.
| Compound Name | 2-phenylsulfanyl-1,3-dioxane |
|---|---|
| PubChem CID | 14388135 |
| Molecular Formula | C10H12O2S |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 2-phenylsulfanyl-1,3-dioxane |
| SMILES | c1ccc(SC2OCCCO2)cc1 |
| InChI | InChI=1S/C10H12O2S/c1-2-5-9(6-3-1)13-10-11-7-4-8-12-10/h1-3,5-6,10H,4,7-8H2 |
| InChIKey | VGEMSBLUCGYCEG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |