About ethane;4,7,7-trimethylcyclohepta[b]pyridin-2-amine
ethane;4,7,7-trimethylcyclohepta[b]pyridin-2-amine (PubChem CID 143881464) has the molecular formula C15H22N2
and a molecular weight of 230.35 g/mol. Its IUPAC name is ethane;4,7,7-trimethylcyclohepta[b]pyridin-2-amine.
Molecular Properties
| Compound Name | ethane;4,7,7-trimethylcyclohepta[b]pyridin-2-amine |
| PubChem CID | 143881464 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | ethane;4,7,7-trimethylcyclohepta[b]pyridin-2-amine |
| SMILES | CC.Cc1cc(N)nc2c1C=CC(C)(C)C=C2 |
| InChI | InChI=1S/C13H16N2.C2H6/c1-9-8-12(14)15-11-5-7-13(2,3)6-4-10(9)11;1-2/h4-8H,1-3H3,(H2,14,15);1-2H3 |
| InChIKey | JLSPFSIDSUDRBX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;4,7,7-trimethylcyclohepta[b]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4,7,7-trimethylcyclohepta[b]pyridin-2-amine?
The IUPAC name of ethane;4,7,7-trimethylcyclohepta[b]pyridin-2-amine (CID 143881464) is ethane;4,7,7-trimethylcyclohepta[b]pyridin-2-amine.
What is the SMILES notation for ethane;4,7,7-trimethylcyclohepta[b]pyridin-2-amine?
The canonical SMILES for ethane;4,7,7-trimethylcyclohepta[b]pyridin-2-amine is CC.Cc1cc(N)nc2c1C=CC(C)(C)C=C2.
What is the InChIKey of ethane;4,7,7-trimethylcyclohepta[b]pyridin-2-amine?
The InChIKey is JLSPFSIDSUDRBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2.C2H6/c1-9-8-12(14)15-11-5-7-13(2,3)6-4-10(9)11;1-2/h4-8H,1-3H3,(H2,14,15);1-2H3.
What are the key properties of ethane;4,7,7-trimethylcyclohepta[b]pyridin-2-amine?
ethane;4,7,7-trimethylcyclohepta[b]pyridin-2-amine has a molecular weight of 230.35 g/mol, XLogP of 4.06, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4,7,7-trimethylcyclohepta[b]pyridin-2-amine is sourced from PubChem (CID 143881464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).