C9H17N3O — CID 143881893
(1E,3Z)-1-morpholin-4-ylpenta-1,3-diene-1,4-diamine (PubChem CID 143881893) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is (1E,3Z)-1-morpholin-4-ylpenta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3Z)-1-morpholin-4-ylpenta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 143881893 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | (1E,3Z)-1-morpholin-4-ylpenta-1,3-diene-1,4-diamine |
| SMILES | C/C(N)=C/C=C(\N)N1CCOCC1 |
| InChI | InChI=1S/C9H17N3O/c1-8(10)2-3-9(11)12-4-6-13-7-5-12/h2-3H,4-7,10-11H2,1H3/b8-2-,9-3+ |
| InChIKey | DMGXGQKLZGBRJT-GPBXNHIQSA-N |
| XLogP | -0.02 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|